
Catalog Number	AR00CWIL
Chemical Name	2,6-Di-tert-butyl-4-chlorophenol
CAS Number	4096-72-4
Molecular Formula	C14H21ClO
Molecular Weight	240.7689
MDL Number	MFCD00087733
SMILES	Clc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C

2,6-Di-tert-butyl-4-chlorophenol, also known as BHT-CP, is a powerful antioxidant widely used in chemical synthesis. Its primary application lies in protecting various compounds from oxidative degradation during reactions and storage. Due to its stable nature, BHT-CP is particularly effective in preventing unwanted side reactions caused by oxidation, thereby ensuring the integrity and quality of the final product. This compound plays a crucial role in enhancing the efficiency and yield of chemical processes by maintaining the stability of sensitive molecules. Moreover, its versatile nature and compatibility with a wide range of substances make it a valuable tool in the synthesis of pharmaceuticals, polymers, and various industrial chemicals.