
Catalog Number	AR00CKT3
Chemical Name	Methyl 1-methyl-2-oxo-2,3-dihydro-1H-1,3-benzimidazole-5-carboxylate
CAS Number	396652-38-3
Molecular Formula	C10H10N2O3
Molecular Weight	206.198
MDL Number	MFCD12922711
SMILES	COC(=O)c1ccc2c(c1)nc(n2C)O

Methyl 1-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate is a versatile compound utilized in chemical synthesis for its unique reactivity and structural properties. This compound serves as a key building block in the preparation of various complex organic molecules and pharmaceutical intermediates. With its functional groups and molecular structure, it can participate in a wide range of chemical reactions, including condensation, cyclization, and substitution reactions, enabling the efficient synthesis of diverse compounds. Additionally, the presence of the ester group in Methyl 1-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate offers opportunities for further derivatization and modification, enhancing its utility in synthetic organic chemistry.