
Catalog Number	AR00CNS2
Chemical Name	Boc-DL-hoMoserine
CAS Number	38308-92-8
Molecular Formula	C9H17NO5
Molecular Weight	219.2350
MDL Number	MFCD02682671
SMILES	OCCC(C(=O)O)NC(=O)OC(C)(C)C

DL-Homoserine, N-[(1,1-dimethylethoxy)carbonyl]- is a versatile compound commonly utilized in chemical synthesis for its ability to serve as a key building block in the preparation of various compounds. It is commonly employed in peptide synthesis as a protecting group for the amino group of homoserine, allowing for controlled reactions and selective modifications at specific sites. This compound plays a crucial role in the formation of peptide bonds and the synthesis of complex molecules in organic chemistry. Its applications extend to the production of pharmaceuticals, agrochemicals, and materials with tailored properties. Its unique chemical properties make it a valuable tool for chemists and researchers seeking to create novel products through precise manipulation of chemical structures.