
Catalog Number	AR00CQYK
Chemical Name	3,3',4,4'-BIPHENYL TETRACARBOXYLIC ACID
CAS Number	36978-37-7
Molecular Formula	C20H18O8
Molecular Weight	386.35211999999984
MDL Number	MFCD13194922
SMILES	COC(=O)c1cc(ccc1C(=O)OC)c1ccc(c(c1)C(=O)OC)C(=O)OC

The [1,1'-Biphenyl]-3,3',4,4'-tetracarboxylic acid, tetramethyl ester is a versatile compound frequently used in chemical synthesis processes. Its unique chemical structure allows it to serve as a key building block in the creation of various advanced materials and functional molecules. In the realm of organic synthesis, this compound plays a crucial role as a starting material for the synthesis of complex organic compounds and polymers. Its ability to undergo selective chemical reactions makes it a valuable tool in the development of innovative materials with tailored properties. Additionally, its tetramethyl ester functionality enables efficient manipulation of its chemical reactivity, allowing for precise control over the synthesis process and the final product characteristics.