
Catalog Number	AR00BWHW
Chemical Name	N-ethyl-N-[(heptadecafluorooctyl)sulphonyl]glycine
CAS Number	2991-50-6
Molecular Formula	C12H8F17NO4S
Molecular Weight	585.2341
MDL Number	MFCD32200806
SMILES	CCN(S(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CC(=O)O

N-Ethyl-N-heptadecylfluorooctane sulfonyl glycine, commonly known as $name$, is a versatile chemical compound widely used in chemical synthesis. This unique molecule serves as an efficient surfactant and coupling agent, facilitating various reactions by lowering the interfacial tension between immiscible phases. In chemical synthesis, $name$ plays a crucial role in promoting organic reactions by aiding in the emulsification of reactants and enhancing the overall reaction efficiency. Its amphiphilic nature allows for effective dispersion of hydrophobic and hydrophilic components, leading to improved reactivity and product yield. Moreover, the specific chemical structure of $name$ provides it with excellent solubility in both organic solvents and aqueous solutions, making it suitable for a wide range of synthetic applications. Whether utilized in biphasic reactions, liquid-liquid extractions, or as a dispersing agent, $name$ demonstrates exceptional compatibility and effectiveness in driving chemical transformations.