
Catalog Number	AR00IMEV
Chemical Name	Diflorasone
CAS Number	2557-49-5
Molecular Formula	C22H28F2O5
Molecular Weight	410.4515
MDL Number	MFCD00200358
SMILES	OCC(=O)[C@@]1(O)[C@@H](C)C[C@@H]2[C@]1(C)C[C@H](O)C1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F

Diflorasone is a synthetic corticosteroid compound that plays a crucial role in chemical synthesis due to its potent anti-inflammatory and immunosuppressive properties. In the realm of organic chemistry, Diflorasone is utilized as a key building block in the development of pharmaceuticals and other bioactive molecules. Its unique structure and reactivity make it a valuable tool for synthesizing various derivatives with enhanced efficacy and specificity. By incorporating Diflorasone into different chemical reactions, researchers can modify its functional groups to create novel compounds for medical applications. Additionally, Diflorasone's ability to regulate immune responses makes it a valuable component in designing drugs to treat inflammatory conditions and autoimmune disorders. Its versatility and effectiveness make Diflorasone a versatile ingredient in the realm of chemical synthesis, offering numerous possibilities for innovative drug development and research.