
Catalog Number	AR01EIMY
Chemical Name	1,3,2-Dioxaborolane, 2-[4-[(4-chlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-
CAS Number	2246937-34-6
Molecular Formula	C19H22BClO3
Molecular Weight	344.6402
MDL Number	MFCD31583310
SMILES	Clc1ccc(cc1)COc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

1,3,2-Dioxaborolane, 2-[4-[(4-chlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl- plays a significant role in chemical synthesis as a versatile building block. This compound is utilized in the formation of various organic molecules through Suzuki-Miyaura cross-coupling reactions. By serving as a boron-containing reagent, it facilitates the creation of complex structures in pharmaceuticals, agrochemicals, and materials science. Its unique structure enables selective and efficient bond formation, making it a valuable tool for organic chemists seeking to synthesize novel compounds with tailored properties.