
Catalog Number	AR00V029
Chemical Name	N-[2-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1-sulfonamide
CAS Number	2246772-82-5
Molecular Formula	C14H21BFNO4S
Molecular Weight	329.1952
MDL Number	MFCD31916423
SMILES	CCS(=O)(=O)Nc1ccc(cc1F)B1OC(C(O1)(C)C)(C)C

The N-(2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanesulfonamide compound plays a crucial role in modern chemical synthesis processes. This versatile chemical reagent serves as a valuable building block in the creation of organic molecules with tailored properties. Particularly, it is commonly employed in the development of pharmaceuticals, agrochemicals, and advanced materials due to its unique structural features and reactivity profile. By strategically incorporating this compound into synthetic schemes, chemists can introduce specific functionalities and structural motifs, facilitating the efficient production of complex molecules with desired properties.