
Catalog Number	AR00ROU2
Chemical Name	1-[2-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylurea
CAS Number	2246583-62-8
Molecular Formula	C14H20BFN2O3
Molecular Weight	294.1296
MDL Number	MFCD11848778
SMILES	CNC(=O)Nc1ccc(cc1F)B1OC(C(O1)(C)C)(C)C

1-(2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3-methylurea is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as a valuable building block in organic chemistry, particularly in the field of medicinal chemistry and materials science. Its functional groups and structural characteristics make it a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Researchers commonly utilize this compound as a precursor for the construction of diverse molecular frameworks through strategic modifications, such as halogenation, alkylation, or coupling reactions. The presence of the boron-containing moiety also enables selective cross-coupling reactions, rendering this compound an essential tool in modern synthetic methodologies. Its ability to undergo diverse transformations highlights its significance in the development of novel compounds with potential applications in drug discovery, materials development, and other chemical industries.