
Catalog Number	AR01DXXC
Chemical Name	3-Bromo-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS Number	2223049-72-5
Molecular Formula	C11H14BBrClNO2
Molecular Weight	318.4024
MDL Number	MFCD16995190
SMILES	Clc1ncc(cc1Br)B1OC(C(O1)(C)C)(C)C

3-Bromo-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a versatile chemical compound widely used in organic synthesis. This compound plays a crucial role in Suzuki-Miyaura cross-coupling reactions, a fundamental tool in modern organic chemistry for the formation of carbon-carbon bonds. Specifically, 3-Bromo-2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine serves as an excellent electrophile in these reactions, allowing for the selective and efficient construction of complex molecular architectures. Additionally, this compound is employed in the synthesis of pharmaceuticals, agrochemicals, and advanced materials, highlighting its significance in the field of chemical synthesis.