
Catalog Number	AR019FNE
Chemical Name	2,4-Dichloro-5-Iodo-7-Methyl-7H-Pyrrolo[2,3-D]Pyrimidine
CAS Number	2007910-59-8
Molecular Formula	C7H4Cl2IN3
Molecular Weight	327.9372
MDL Number	MFCD30189397
SMILES	Clc1nc(Cl)c2c(n1)n(C)cc2I

The compound 2,4-Dichloro-5-iodo-7-methyl-7H-pyrrolo[2,3-d]pyrimidine is a versatile building block in chemical synthesis. Due to its unique molecular structure, it is commonly used in the preparation of various complex organic molecules with specific desired properties. In organic synthesis, this compound can serve as a key intermediate for the creation of novel pharmaceuticals, agrochemicals, and materials with advanced functionalities. Its strategic placement of halogen substituents makes it a valuable tool for facilitating diverse chemical transformations, such as halogenation reactions, cross-coupling reactions, and heterocyclic ring formations. By incorporating 2,4-Dichloro-5-iodo-7-methyl-7H-pyrrolo[2,3-d]pyrimidine into synthetic pathways, chemists can access a wide range of structurally diverse compounds with potential applications in drug discovery, materials science, and other areas of chemical research.