
Catalog Number	AR00ASHB
Chemical Name	N-isopropyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide
CAS Number	1704122-04-2
Molecular Formula	C17H26BNO4
Molecular Weight	319.2036
MDL Number	MFCD28952842
SMILES	CC(NC(=O)COc1ccc(cc1)B1OC(C(O1)(C)C)(C)C)C

N-Isopropyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetamide is a versatile compound that finds significant utility in chemical synthesis. This molecule serves as an essential building block in the creation of various advanced materials and pharmaceuticals. In organic synthesis, it acts as a key reagent for the introduction of specific functional groups, enabling the modification and manipulation of molecular structures with precision. Its unique chemical properties make it a valuable tool for the development of novel compounds and the exploration of new synthetic pathways.