
Catalog Number	AR00ARYY
Chemical Name	(3,5-Dimethyl-4-(pyrrolidin-1-ylsulfonyl)phenyl)boronic acid
CAS Number	1704066-99-8
Molecular Formula	C12H18BNO4S
Molecular Weight	283.15162
MDL Number	MFCD28384278
SMILES	Cc1cc(cc(c1S(=O)(=O)N1CCCC1)C)B(O)O

Boronic acid, B-[3,5-dimethyl-4-(1-pyrrolidinylsulfonyl)phenyl]- is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This specific boronic acid derivative finds significant application in Suzuki-Miyaura cross-coupling reactions, a fundamental transformation in organic chemistry. Through the formation of stable boron-carbon bonds, this compound effectively serves as a key building block in the construction of complex molecular structures. Its reactivity under mild reaction conditions makes it a valuable tool for the preparation of pharmaceuticals, agrochemicals, and materials with precise control over molecular architecture.