
Catalog Number	AR00ACAL
Chemical Name	(AR,BS)-ALPHA-(4-HYDROXYPHENYL)-BETA-METHYL-4-(PHENYLMETHYL)-1-PIPERIDINEPROPANOL MALEATE
CAS Number	169274-78-6
Molecular Formula	C22H29NO2
Molecular Weight	339.4712
MDL Number	MFCD06798375
SMILES	C[C@H]([C@H](c1ccc(cc1)O)O)CN1CCC(CC1)Cc1ccccc1

The compound (αR,βS)-α-(4-Hydroxyphenyl)-β-methyl-4-(phenylmethyl)-1-piperidinepropanol has significant applications in chemical synthesis due to its stereochemistry and functional groups. In chemical synthesis, this compound can serve as a key intermediate or building block for the preparation of various pharmaceuticals, such as potential drug candidates or active pharmaceutical ingredients.Due to its chiral nature, (αR,βS)-α-(4-Hydroxyphenyl)-β-methyl-4-(phenylmethyl)-1-piperidinepropanol can be utilized in the synthesis of enantiopure compounds, which are crucial in drug development and medicinal chemistry. Its specific structural features, including the hydroxyl group, aromatic phenyl moiety, and piperidine ring, offer opportunities for versatile chemical transformations and functional group interconversions, enabling the creation of structurally diverse molecules with tailored properties.Moreover, the presence of the β-methyl group in (αR,βS)-α-(4-Hydroxyphenyl)-β-methyl-4-(phenylmethyl)-1-piperidinepropanol can influence the compound's reactivity and selectivity in synthetic reactions, leading to the formation of stereochemically complex compounds with potential biological activities. Overall, the strategic incorporation of this compound in chemical synthesis can facilitate the construction of molecular scaffolds with desired stereochemical arrangements and functional groups for targeted drug discovery and synthetic applications.