
Catalog Number	AR00INEA
Chemical Name	4-[4-(Trifluoromethoxy)phenoxy]benzenemethanol
CAS Number	1686102-84-0
Molecular Formula	C14H11F3O3
Molecular Weight	284.2305
MDL Number	MFCD29058619
SMILES	OCc1ccc(cc1)Oc1ccc(cc1)OC(F)(F)F

(4-(4-(Trifluoromethoxy)phenoxy)phenyl)methanol is a versatile compound widely used in chemical synthesis as a key building block. Its unique structure and properties make it an essential component in the creation of various organic molecules and materials. This compound serves as a valuable intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals due to its ability to undergo various chemical transformations. Additionally, its presence in the synthesis of polymers and advanced materials highlights its importance in the field of materials science. In summary, the application of (4-(4-(Trifluoromethoxy)phenoxy)phenyl)methanol in chemical synthesis contributes significantly to the development of diverse compounds with wide-ranging industrial and research applications.