
Catalog Number	AR007K0W
Chemical Name	Ginkgolide B
CAS Number	15291-77-7
Molecular Formula	C20H24O10
Molecular Weight	424.3986
MDL Number	MFCD05662347
SMILES	O=C1OC2C(C1C)(O)C13C4(C2O)C(OC3=O)CC(C24C(O1)OC(=O)C2O)C(C)(C)C
NSC Number	110257

Ginkgolide B, a natural compound derived from the Ginkgo biloba tree, plays a crucial role in chemical synthesis as a versatile building block in the creation of various pharmaceuticals and bioactive molecules. With its unique molecular structure and functional groups, Ginkgolide B serves as a valuable starting material for the synthesis of complex organic molecules through various chemical transformations. This compound is particularly prized for its ability to serve as a chiral scaffold, enabling the production of enantiomerically pure compounds important in drug development and medicinal chemistry. Additionally, Ginkgolide B's pharmacological properties make it an attractive candidate for the design and synthesis of new drug candidates targeting a range of health conditions. In the realm of chemical synthesis, Ginkgolide B stands out as a valuable tool for the creation of novel compounds with potential therapeutic applications.