
Catalog Number	AR00AS9A
Chemical Name	2-(4-Methylpiperazin-1-yl)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide
CAS Number	1480399-95-8
Molecular Formula	C19H30BN3O3
Molecular Weight	359.2708
MDL Number	MFCD28805651
SMILES	CN1CCN(CC1)CC(=O)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

2-(4-Methylpiperazin-1-yl)-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide is a versatile compound used in chemical synthesis as a key building block for the creation of various pharmaceuticals and organic compounds. This compound serves as a valuable intermediate in the synthesis of complex molecules due to its unique structure and reactivity. Its functionality allows for the introduction of specific functional groups and structural motifs into target molecules, enabling chemists to design and synthesize novel compounds with tailored properties. This compound plays a crucial role in the development of new drugs, agrochemicals, and materials by serving as a critical component in the construction of more complex and diverse chemical structures.