
Catalog Number	AR00RCXV
Chemical Name	N-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1-sulfonamide
CAS Number	1469930-90-2
Molecular Formula	C14H22BNO4S
Molecular Weight	311.2048
MDL Number	MFCD31916411
SMILES	CCS(=O)(=O)Nc1cccc(c1)B1OC(C(O1)(C)C)(C)C

N-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide is a highly versatile compound widely used in chemical synthesis as a key reagent for cross-coupling reactions. This compound serves as a valuable building block for the construction of complex organic molecules, particularly in the field of medicinal chemistry and material science. Its unique molecular structure provides a stable platform for the introduction of functional groups and allows for the selective modification of target molecules. In particular, N-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide is commonly employed in the synthesis of pharmaceutical intermediates, agrochemicals, and advanced materials. Its efficient reactivity and compatibility with a variety of coupling partners make it an indispensable tool for chemists seeking to streamline their synthetic routes and enhance their overall synthetic efficiency.