
Catalog Number	AR00HWHE
Chemical Name	Chromiumacetonylacetonate
CAS Number	14024-48-7
Molecular Formula	C10H14CoO4
Molecular Weight	257.14896
MDL Number	MFCD00000014
SMILES	CC1=[O][Co+2]2([O]=C([CH-]1)C)[O]=C(C)[CH-]C(=[O]2)C

Cobalt(II) bis(acetylacetonate) is a versatile compound commonly used in chemical synthesis as a catalyst for various reactions. Its unique structure and properties make it a valuable tool in organic chemistry processes.In chemical synthesis, Cobalt(II) bis(acetylacetonate) serves as a catalyst in the formation of carbon-carbon bonds through cross-coupling reactions. This compound can facilitate the coupling of organometallic reagents with organic substrates, leading to the creation of new carbon-carbon bonds. This is particularly useful in the synthesis of complex organic molecules, such as pharmaceuticals, agrochemicals, and materials.Additionally, Cobalt(II) bis(acetylacetonate) can also catalyze various oxidation reactions, such as the oxidation of alcohols to aldehydes or ketones. This enables chemists to efficiently transform functional groups in organic molecules, expanding the toolbox of synthetic methodologies available.Overall, the application of Cobalt(II) bis(acetylacetonate) in chemical synthesis offers chemists a powerful and versatile catalyst to facilitate the efficient and selective formation of carbon-carbon bonds and oxidations, ultimately aiding in the synthesis of valuable compounds.