
Catalog Number	AR01DECG
Chemical Name	3-((2S)Pyrrolidin-2-YL)-4-methoxybenzoic acid
CAS Number	1391419-55-8
Molecular Formula	C12H15NO3
Molecular Weight	221.2524
MDL Number	MFCD12758985
SMILES	COc1ccc(cc1[C@@H]1CCCN1)C(=O)O

The (S)-4-Methoxy-3-(pyrrolidin-2-yl)benzoic acid hydrochloride is a key compound utilized in chemical synthesis processes for its versatile applications. Known for its chirality, this compound plays a crucial role in asymmetric synthesis, allowing for the creation of enantiopure molecules, which are vital in industries such as pharmaceuticals and agrochemicals.In chemical synthesis, (S)-4-Methoxy-3-(pyrrolidin-2-yl)benzoic acid hydrochloride acts as a chiral building block, enabling the production of highly pure and specific compounds. Its unique structure and properties make it a valuable tool in the creation of complex organic molecules with defined stereochemistry, essential for the development of new drugs and fine chemicals.This compound is particularly prized for its ability to influence the stereochemistry of reactions, leading to the selective formation of desired enantiomers. By incorporating (S)-4-Methoxy-3-(pyrrolidin-2-yl)benzoic acid hydrochloride into chemical syntheses, chemists can enhance the efficiency and selectivity of reactions, ultimately facilitating the production of high-quality compounds with precise structural characteristics.Overall, the application of (S)-4-Methoxy-3-(pyrrolidin-2-yl)benzoic acid hydrochloride in chemical synthesis demonstrates its significant role in the advancement of synthetic methodologies and the creation of valuable molecules with specific stereochemical properties.