
Catalog Number	AR003W4X
Chemical Name	Lobeline hydrochloride
CAS Number	134-63-4
Molecular Formula	C22H28ClNO2
Molecular Weight	373.9162
MDL Number	MFCD00082455
SMILES	OC(c1ccccc1)CC1CCCC(N1C)CC(=O)c1ccccc1.Cl
NSC Number	757421

Lobeline hydrochloride is a versatile compound widely used in chemical synthesis for its unique properties and applications. Known for its ability to act as a nicotinic acetylcholine receptor agonist, it plays a crucial role in various synthetic reactions. By serving as a catalyst or reagent, Lobeline hydrochloride facilitates the formation of complex organic molecules and the modification of existing chemical structures. This compound is particularly valued in the pharmaceutical industry for its role in the development of novel drug candidates and therapeutic agents. Additionally, Lobeline hydrochloride's proficiency in promoting specific chemical reactions makes it a valuable tool in the production of specialty chemicals and research compounds. Its versatile nature and diverse applications in chemical synthesis make Lobeline hydrochloride an indispensable component in the toolkit of chemists and researchers alike.