
Catalog Number	AR01DUEV
Chemical Name	[3-fluoro-4-(thiomorpholin-4-ylmethyl)phenyl]boronic acid
CAS Number	1334171-29-7
Molecular Formula	C11H15BFNO2S
Molecular Weight	255.1167
MDL Number	MFCD16198148
SMILES	Fc1cc(ccc1CN1CCSCC1)B(O)O

The (3-Fluoro-4-(thiomorpholinomethyl)phenyl)boronic acid is a versatile compound widely utilized in chemical synthesis for its unique properties and functional groups. This boronic acid derivative acts as a crucial building block in the construction of various organic molecules through Suzuki-Miyaura cross-coupling reactions. Specifically, its fluoro substituent provides an important handle for further chemical modifications, enabling precise control over the molecular structure and properties of the desired products. Additionally, the thiomorpholinomethyl group serves as a valuable moiety for enhancing the compound's reactivity and selectivity in various synthetic transformations. Overall, the (3-Fluoro-4-(thiomorpholinomethyl)phenyl)boronic acid plays a pivotal role in the synthesis of complex organic compounds with potential applications in pharmaceuticals, agrochemicals, and materials science.