
Catalog Number	AR009Z6C
Chemical Name	2-((4-Methylpiperidin-1-yl)methyl)phenylboronic acid
CAS Number	1313737-75-5
Molecular Formula	C13H20BNO2
Molecular Weight	233.1144
MDL Number	MFCD16198058
SMILES	CC1CCN(CC1)Cc1ccccc1B(O)O

The compound [2-[(4-Methylpiperidin-1-yl)methyl]phenyl]boranediol is a versatile reagent commonly utilized in chemical synthesis. It serves as a valuable building block in organic chemistry, facilitating the formation of complex molecular structures with specific functionalities. This compound is particularly useful in the preparation of pharmaceutical intermediates, agrochemicals, and advanced materials. Its unique boron-containing structure enables selective transformations in organic reactions, making it a valuable tool for synthetic chemists aiming to access diverse chemical space. In addition, its stability and compatibility with a variety of reaction conditions further enhance its utility in modern synthetic methodologies.