
Catalog Number	AR009Z6B
Chemical Name	2-((4-Methylpiperazin-1-yl)Methyl)phenylboronic acid
CAS Number	1312921-22-4
Molecular Formula	C12H19BN2O2
Molecular Weight	234.1025
MDL Number	MFCD16198079
SMILES	CN1CCN(CC1)Cc1ccccc1B(O)O

Boronic acid, B-[2-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a versatile compound commonly used in chemical synthesis as a key building block for pharmaceuticals and organic materials. This specific boronic acid derivative is valued for its ability to participate in Suzuki-Miyaura coupling reactions, forming carbon-carbon bonds that are crucial in the synthesis of complex molecules. By serving as a coupling partner with aryl halides or pseudohalides, this compound enables the efficient creation of highly functionalized intermediates and final products. Its unique structure incorporating a phenyl and piperazine moiety further enhances its utility in drug discovery and material science applications.