
Catalog Number	AR000X7N
Chemical Name	Benzenesulfonic acid, 3-nitro-, sodium salt (1:1)
CAS Number	127-68-4
Molecular Formula	C6H4NNaO5S
Molecular Weight	225.1544
MDL Number	MFCD02662351
SMILES	[O-][N+](=O)c1cccc(c1)S(=O)(=O)[O-].[Na+]

Sodium 3-Nitrobenzenesulphonate is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable reagent in the preparation of various organic molecules and has found wide application in the pharmaceutical and agrochemical industries. In organic synthesis, Sodium 3-Nitrobenzenesulphonate acts as a strong electrophile, participating in various nucleophilic substitution reactions to introduce the nitrobenzenesulphonate group into target molecules. This functional group can serve as a precursor for further derivatization, allowing chemists to introduce additional functionalities or alter the physicochemical properties of a compound. Additionally, Sodium 3-Nitrobenzenesulphonate can act as a nitro source in the synthesis of nitroarenes or in the preparation of nitro-containing heterocycles. Its ease of handling and compatibility with a wide range of reaction conditions make it a valuable tool for organic chemists seeking to access diverse chemical structures for academic or industrial purposes.