
Catalog Number	AR01FLOG
Chemical Name	4,4,5,5-Tetramethyl-2-(4-(o-tolyloxymethyl)phenyl)-1,3,2-dioxaborolane
CAS Number	1262404-82-9
Molecular Formula	C20H25BO3
Molecular Weight	324.2217
MDL Number	MFCD22493769
SMILES	Cc1ccccc1OCc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

4,4,5,5-Tetramethyl-2-(4-(o-tolyloxymethyl)phenyl)-1,3,2-dioxaborolane is a versatile compound that finds wide applications in chemical synthesis. One of its key uses is as a boronic ester derivative in organic reactions, particularly in palladium-catalyzed cross-coupling reactions.This compound serves as a valuable building block for the construction of complex organic molecules due to its unique structure and reactivity. Its boron functionality allows for selective transformations and enables the introduction of aryl and alkyl groups into various substrates.In chemical synthesis, 4,4,5,5-Tetramethyl-2-(4-(o-tolyloxymethyl)phenyl)-1,3,2-dioxaborolane is commonly employed in the formation of carbon-carbon bonds, such as in Suzuki-Miyaura coupling reactions. By participating in these cross-coupling reactions, it facilitates the creation of biaryl compounds, which are prevalent in pharmaceuticals, agrochemicals, and materials science.Moreover, this compound can be utilized in the development of new materials, ligands, and pharmaceutical intermediates, showcasing its significance in modern organic chemistry research and industrial applications.