
Catalog Number	AR01EING
Chemical Name	N-(4-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
CAS Number	1259285-60-3
Molecular Formula	C19H23BFNO2
Molecular Weight	327.2008
MDL Number	MFCD31916444
SMILES	Fc1ccc(cc1)CNc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

The compound N-(4-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is a versatile building block in chemical synthesis. It is commonly used as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and advanced materials. With its unique structural features, this compound serves as a crucial component in the formation of complex organic molecules through various synthetic pathways. Additionally, its selective reactivity and compatibility with a wide range of functional groups make it a valuable tool for designing and creating new chemical entities with desired properties.