
Catalog Number	AR00HHXZ
Chemical Name	N,2-Dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
CAS Number	1233526-90-3
Molecular Formula	C15H22BNO3
Molecular Weight	275.1511
MDL Number	MFCD18383585
SMILES	CNC(=O)c1ccc(cc1C)B1OC(C(O1)(C)C)(C)C

N,2-Dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a versatile reagent widely used in chemical synthesis as a key building block in organic reactions. This compound serves as a valuable intermediate in the formation of various functional molecules due to its unique chemical properties and structural characteristics. In particular, it is frequently employed in cross-coupling reactions, such as Suzuki-Miyaura coupling, to enable the synthesis of complex organic compounds. Additionally, N,2-Dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide can act as a masked amine source in reductive amination reactions, facilitating the introduction of primary and secondary amines into target molecules. Its compatibility with a wide range of functional groups and its role in promoting selective bond formation make it a valuable tool for synthetic chemists seeking to efficiently access structurally diverse compounds.