
Catalog Number	AR000BR8
Chemical Name	3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-
CAS Number	114311-32-9
Molecular Formula	C15H19N3O4
Molecular Weight	305.3291
MDL Number	MFCD03427427
SMILES	COCc1cnc(c(c1)C(=O)O)C1=NC(C(=O)N1)(C)C(C)C

The compound 2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-3-pyridinecarboxylic acid, also known as $name$, serves as a valuable reagent in chemical synthesis processes. Its unique structure and functional groups make it a versatile molecule for various synthetic applications. $name$ can be used as a key building block in the synthesis of complex organic compounds due to its reactive imidazole and pyridine moieties. These functional groups can participate in various chemical reactions such as condensation, acylation, and nucleophilic substitution, allowing for the formation of new bonds and the creation of structurally diverse molecules. In addition, the methoxymethyl group in $name$ can serve as a protecting group, safeguarding specific functional groups during multi-step synthetic pathways. By leveraging the reactivity and selectivity of $name$, chemists can efficiently access target compounds with precise control over regioselectivity and stereochemistry.

3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-

114311-32-9

Product Details