
Catalog Number	AR00QH83
Chemical Name	2-methoxy-N-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide
CAS Number	1036990-20-1
Molecular Formula	C15H22BNO4
Molecular Weight	291.1505
MDL Number	MFCD22494280
SMILES	COCC(=O)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

The compound 2-methoxy-N-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide is commonly used as a key building block in chemical synthesis processes. Its unique structure and reactivity make it an important intermediate in the creation of various organic compounds. Specifically, this compound serves as a versatile reagent in Suzuki-Miyaura cross-coupling reactions, enabling the formation of complex molecular structures through the selective coupling of aryl halides with boronic acids or esters. Additionally, the presence of the tetramethyl-1,3,2-dioxaborolane moiety in the molecule enhances its stability and compatibility in diverse reaction conditions, making it a highly valuable tool in modern synthetic chemistry.