
Catalog Number	AR007IJG
Chemical Name	GP-pNA, Chromogenic Substrate
CAS Number	103213-34-9
Molecular Formula	C13H17ClN4O4
Molecular Weight	328.7515
MDL Number	MFCD00058170
SMILES	NCC(=O)N1CCCC1C(=O)Nc1ccc(cc1)N(=O)=O.Cl

Gly-Pro p-nitroanilide hydrochloride is a versatile compound used in chemical synthesis for the development of biologically active peptides. As a substrate for enzyme-catalyzed reactions, Gly-Pro p-nitroanilide hydrochloride is especially valuable in studying the specific activity of enzymes such as prolyl oligopeptidase. This compound serves as a valuable tool in the field of peptide chemistry and enzymology, allowing researchers to investigate peptide bond cleavage and analyze enzyme kinetics. With its precise and controlled reactivity, Gly-Pro p-nitroanilide hydrochloride plays a crucial role in the design and synthesis of novel peptides with potential therapeutic applications.