
Catalog Number	AR01FGNK
Chemical Name	1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[(3-methylphenyl)methoxy]phenyl]-
CAS Number	1029439-14-2
Molecular Formula	C20H25BO3
Molecular Weight	324.2217
MDL Number	MFCD22493805
SMILES	Cc1cccc(c1)COc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

4,4,5,5-Tetramethyl-2-(4-((3-methylbenzyl)oxy)phenyl)-1,3,2-dioxaborolane is a versatile building block widely used in chemical synthesis for the formation of pharmaceuticals, agrochemicals, and materials. It serves as a key reagent in Suzuki-Miyaura cross-coupling reactions, enabling the efficient construction of complex molecular structures. This compound's unique structure containing boron and oxygen atoms facilitates its participation in diverse transformations, making it a valuable tool for the synthesis of novel compounds with tailored properties. In addition to its role in carbon-carbon bond formation, it has also been employed in the synthesis of functional polymers and organic electronic materials, highlighting its broad utility in contemporary synthetic chemistry.