
Catalog Number	AR00058C
Chemical Name	Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester, hydrochloride (1:1)
CAS Number	1014645-87-4
Molecular Formula	C11H14ClNO2
Molecular Weight	227.6874
MDL Number	MFCD11616336
SMILES	COC(=O)c1ccc(cc1)C1(N)CC1.Cl

Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester, hydrochloride (1:1) is a versatile chemical compound commonly used in chemical synthesis processes. It serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, this compound is particularly valued for its ability to participate in diverse reactions, such as acylation, alkylation, and condensation reactions. Its unique structure and reactivity make it an indispensable building block for creating complex organic molecules with specific pharmacological or biological activities.Researchers and chemists frequently utilize Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester, hydrochloride (1:1) in the development of novel drug candidates, agrochemical formulations, and other fine chemicals. Its consistent performance and compatibility with various reaction conditions make it a reliable choice for exploring new synthetic pathways and designing advanced chemical structures.